C6H7F2N — CID 143838516
(Z,E)-4-fluoro-N-(1-fluoroethenyl)but-3-en-2-imine (PubChem CID 143838516) has the molecular formula C6H7F2N and a molecular weight of 131.12 g/mol. Its IUPAC name is (Z,E)-4-fluoro-N-(1-fluoroethenyl)but-3-en-2-imine.
| Compound Name | (Z,E)-4-fluoro-N-(1-fluoroethenyl)but-3-en-2-imine |
|---|---|
| PubChem CID | 143838516 |
| Molecular Formula | C6H7F2N |
| Molecular Weight | 131.12 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | (Z,E)-4-fluoro-N-(1-fluoroethenyl)but-3-en-2-imine |
| SMILES | C=C(F)/N=C(C)\C=C\F |
| InChI | InChI=1S/C6H7F2N/c1-5(3-4-7)9-6(2)8/h3-4H,2H2,1H3/b4-3+,9-5- |
| InChIKey | QQEAANUUFFAKMM-BEHOXYOFSA-N |
| XLogP | 2.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|