C9H6BrFN2 — CID 146260017
(Z,4Z)-4-(2-bromoprop-2-enylidene)-3-fluoro-2-methylpent-2-enedinitrile (PubChem CID 146260017) has the molecular formula C9H6BrFN2 and a molecular weight of 241.06 g/mol. Its IUPAC name is (Z,4Z)-4-(2-bromoprop-2-enylidene)-3-fluoro-2-methylpent-2-enedinitrile.
| Compound Name | (Z,4Z)-4-(2-bromoprop-2-enylidene)-3-fluoro-2-methylpent-2-enedinitrile |
|---|---|
| PubChem CID | 146260017 |
| Molecular Formula | C9H6BrFN2 |
| Molecular Weight | 241.06 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | (Z,4Z)-4-(2-bromoprop-2-enylidene)-3-fluoro-2-methylpent-2-enedinitrile |
| SMILES | C=C(Br)/C=C(C#N)\C(F)=C(/C)C#N |
| InChI | InChI=1S/C9H6BrFN2/c1-6(4-12)9(11)8(5-13)3-7(2)10/h3H,2H2,1H3/b8-3-,9-6- |
| InChIKey | ZNBBLHYPDPWWAQ-AIKKHQNGSA-N |
| XLogP | 3.11 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.06 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|