C10H10BrN3 — CID 142874050
N-[(3E)-5-bromo-3-cyanohexa-1,3,5-trien-2-yl]-N'-ethenylmethanimidamide (PubChem CID 142874050) has the molecular formula C10H10BrN3 and a molecular weight of 252.11 g/mol. Its IUPAC name is N-[(3E)-5-bromo-3-cyanohexa-1,3,5-trien-2-yl]-N'-ethenylmethanimidamide.
| Compound Name | N-[(3E)-5-bromo-3-cyanohexa-1,3,5-trien-2-yl]-N'-ethenylmethanimidamide |
|---|---|
| PubChem CID | 142874050 |
| Molecular Formula | C10H10BrN3 |
| Molecular Weight | 252.11 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | N-[(3E)-5-bromo-3-cyanohexa-1,3,5-trien-2-yl]-N'-ethenylmethanimidamide |
| SMILES | C=C/N=C/NC(=C)/C(C#N)=C\C(=C)Br |
| InChI | InChI=1S/C10H10BrN3/c1-4-13-7-14-9(3)10(6-12)5-8(2)11/h4-5,7H,1-3H2,(H,13,14)/b10-5- |
| InChIKey | VPUHCGLHOHANEE-YHYXMXQVSA-N |
| XLogP | 2.62 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|