C9H11BrN2 — CID 144556556
3-(2-bromoprop-2-enylideneamino)-2,2-dimethylbut-3-enenitrile (PubChem CID 144556556) has the molecular formula C9H11BrN2 and a molecular weight of 227.10 g/mol. Its IUPAC name is 3-(2-bromoprop-2-enylideneamino)-2,2-dimethylbut-3-enenitrile.
| Compound Name | 3-(2-bromoprop-2-enylideneamino)-2,2-dimethylbut-3-enenitrile |
|---|---|
| PubChem CID | 144556556 |
| Molecular Formula | C9H11BrN2 |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 3-(2-bromoprop-2-enylideneamino)-2,2-dimethylbut-3-enenitrile |
| SMILES | C=C(Br)/C=N/C(=C)C(C)(C)C#N |
| InChI | InChI=1S/C9H11BrN2/c1-7(10)5-12-8(2)9(3,4)6-11/h5H,1-2H2,3-4H3/b12-5+ |
| InChIKey | DWBMRQQOGGOWKA-LFYBBSHMSA-N |
| XLogP | 3.03 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|