About methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate
methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate (PubChem CID 156542257) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate.
Molecular Properties
| Compound Name | methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate |
| PubChem CID | 156542257 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate |
| SMILES | C=C(/N=C/C(=N/C)OC)C(C)(C)C |
| InChI | InChI=1S/C10H18N2O/c1-8(10(2,3)4)12-7-9(11-5)13-6/h7H,1H2,2-6H3/b11-9-,12-7+ |
| InChIKey | CXYRGUYYAXFOFM-UNXYAYAESA-N |
| XLogP | 2.29 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate?
The IUPAC name of methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate (CID 156542257) is methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate.
What is the SMILES notation for methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate?
The canonical SMILES for methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate is C=C(/N=C/C(=N/C)OC)C(C)(C)C.
What is the InChIKey of methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate?
The InChIKey is CXYRGUYYAXFOFM-UNXYAYAESA-N. The full InChI is InChI=1S/C10H18N2O/c1-8(10(2,3)4)12-7-9(11-5)13-6/h7H,1H2,2-6H3/b11-9-,12-7+.
What are the key properties of methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate?
methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate has a molecular weight of 182.27 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate is sourced from PubChem (CID 156542257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).