C10H18N2O — CID 156542257
methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate (PubChem CID 156542257) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate.
| Compound Name | methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate |
|---|---|
| PubChem CID | 156542257 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | methyl 2-(3,3-dimethylbut-1-en-2-ylimino)-N-methylethanimidate |
| SMILES | C=C(/N=C/C(=N/C)OC)C(C)(C)C |
| InChI | InChI=1S/C10H18N2O/c1-8(10(2,3)4)12-7-9(11-5)13-6/h7H,1H2,2-6H3/b11-9-,12-7+ |
| InChIKey | CXYRGUYYAXFOFM-UNXYAYAESA-N |
| XLogP | 2.29 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|