C7H6BrFN2 — CID 167284948
(2E,4E)-5-bromo-3-fluoro-2-(methylideneamino)hexa-2,4-dienenitrile (PubChem CID 167284948) has the molecular formula C7H6BrFN2 and a molecular weight of 217.04 g/mol. Its IUPAC name is (2E,4E)-5-bromo-3-fluoro-2-(methylideneamino)hexa-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-bromo-3-fluoro-2-(methylideneamino)hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 167284948 |
| Molecular Formula | C7H6BrFN2 |
| Molecular Weight | 217.04 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | (2E,4E)-5-bromo-3-fluoro-2-(methylideneamino)hexa-2,4-dienenitrile |
| SMILES | C=N/C(C#N)=C(F)\C=C(/C)Br |
| InChI | InChI=1S/C7H6BrFN2/c1-5(8)3-6(9)7(4-10)11-2/h3H,2H2,1H3/b5-3+,7-6+ |
| InChIKey | PUHMHBPTRYAPLD-TWTPFVCWSA-N |
| XLogP | 2.69 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.04 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|