C8H8F3N3 — CID 155371245
(2E,4E)-5-amino-2-(methylideneamino)-3-(trifluoromethyl)hexa-2,4-dienenitrile (PubChem CID 155371245) has the molecular formula C8H8F3N3 and a molecular weight of 203.17 g/mol. Its IUPAC name is (2E,4E)-5-amino-2-(methylideneamino)-3-(trifluoromethyl)hexa-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-amino-2-(methylideneamino)-3-(trifluoromethyl)hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 155371245 |
| Molecular Formula | C8H8F3N3 |
| Molecular Weight | 203.17 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | (2E,4E)-5-amino-2-(methylideneamino)-3-(trifluoromethyl)hexa-2,4-dienenitrile |
| SMILES | C=N/C(C#N)=C(\C=C(/C)N)C(F)(F)F |
| InChI | InChI=1S/C8H8F3N3/c1-5(13)3-6(8(9,10)11)7(4-12)14-2/h3H,2,13H2,1H3/b5-3+,7-6+ |
| InChIKey | UMLZXBWSOIXVOV-TWTPFVCWSA-N |
| XLogP | 1.89 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|