C9H6F3N3O — CID 137445258
(2E,4E)-2-amino-5-isocyanato-3-(trifluoromethyl)hepta-2,4,6-trienenitrile (PubChem CID 137445258) has the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. Its IUPAC name is (2E,4E)-2-amino-5-isocyanato-3-(trifluoromethyl)hepta-2,4,6-trienenitrile.
| Compound Name | (2E,4E)-2-amino-5-isocyanato-3-(trifluoromethyl)hepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 137445258 |
| Molecular Formula | C9H6F3N3O |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | (2E,4E)-2-amino-5-isocyanato-3-(trifluoromethyl)hepta-2,4,6-trienenitrile |
| SMILES | C=C/C(=C\C(=C(/N)C#N)C(F)(F)F)N=C=O |
| InChI | InChI=1S/C9H6F3N3O/c1-2-6(15-5-16)3-7(8(14)4-13)9(10,11)12/h2-3H,1,14H2/b6-3+,8-7+ |
| InChIKey | QPOFHCZLQZQKDH-ZICOWINBSA-N |
| XLogP | 1.69 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|