About 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid)
2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid) (PubChem CID 175460644) has the molecular formula C10H11NO7
and a molecular weight of 257.20 g/mol. Its IUPAC name is 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid).
Molecular Properties
| Compound Name | 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid) |
| PubChem CID | 175460644 |
| Molecular Formula | C10H11NO7 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid) |
| SMILES | C=C(N=C=O)C(=O)O.C=CC(=O)O.C=CC(=O)O |
| InChI | InChI=1S/C4H3NO3.2C3H4O2/c1-3(4(7)8)5-2-6;2*1-2-3(4)5/h1H2,(H,7,8);2*2H,1H2,(H,4,5) |
| InChIKey | WUDJWRBGWABENE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid)?
The IUPAC name of 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid) (CID 175460644) is 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid).
What is the SMILES notation for 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid)?
The canonical SMILES for 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid) is C=C(N=C=O)C(=O)O.C=CC(=O)O.C=CC(=O)O.
What is the InChIKey of 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid)?
The InChIKey is WUDJWRBGWABENE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO3.2C3H4O2/c1-3(4(7)8)5-2-6;2*1-2-3(4)5/h1H2,(H,7,8);2*2H,1H2,(H,4,5).
What are the key properties of 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid)?
2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid) has a molecular weight of 257.20 g/mol, XLogP of 0.43, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanatoprop-2-enoic acid;bis(prop-2-enoic acid) is sourced from PubChem (CID 175460644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).