About carbon dioxide;prop-2-enoic acid
carbon dioxide;prop-2-enoic acid (PubChem CID 91485631) has the molecular formula C4H4O4
and a molecular weight of 116.07 g/mol. Its IUPAC name is carbon dioxide;prop-2-enoic acid.
Molecular Properties
| Compound Name | carbon dioxide;prop-2-enoic acid |
| PubChem CID | 91485631 |
| Molecular Formula | C4H4O4 |
| Molecular Weight | 116.07 g/mol |
| Exact Mass | 116.01 |
| IUPAC Name | carbon dioxide;prop-2-enoic acid |
| SMILES | C=CC(=O)O.O=C=O |
| InChI | InChI=1S/C3H4O2.CO2/c1-2-3(4)5;2-1-3/h2H,1H2,(H,4,5); |
| InChIKey | ZXNWQVCASLRUSJ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.07 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;prop-2-enoic acid?
The IUPAC name of carbon dioxide;prop-2-enoic acid (CID 91485631) is carbon dioxide;prop-2-enoic acid.
What is the SMILES notation for carbon dioxide;prop-2-enoic acid?
The canonical SMILES for carbon dioxide;prop-2-enoic acid is C=CC(=O)O.O=C=O.
What is the InChIKey of carbon dioxide;prop-2-enoic acid?
The InChIKey is ZXNWQVCASLRUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.CO2/c1-2-3(4)5;2-1-3/h2H,1H2,(H,4,5);.
What are the key properties of carbon dioxide;prop-2-enoic acid?
carbon dioxide;prop-2-enoic acid has a molecular weight of 116.07 g/mol, XLogP of -0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;prop-2-enoic acid is sourced from PubChem (CID 91485631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).