About propa-1,2-diene;prop-2-enoic acid
propa-1,2-diene;prop-2-enoic acid (PubChem CID 87528700) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is propa-1,2-diene;prop-2-enoic acid.
Molecular Properties
| Compound Name | propa-1,2-diene;prop-2-enoic acid |
| PubChem CID | 87528700 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | propa-1,2-diene;prop-2-enoic acid |
| SMILES | C=C=C.C=CC(=O)O |
| InChI | InChI=1S/C3H4O2.C3H4/c1-2-3(4)5;1-3-2/h2H,1H2,(H,4,5);1-2H2 |
| InChIKey | AIAQRKDMSYYIAY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propa-1,2-diene;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propa-1,2-diene;prop-2-enoic acid?
The IUPAC name of propa-1,2-diene;prop-2-enoic acid (CID 87528700) is propa-1,2-diene;prop-2-enoic acid.
What is the SMILES notation for propa-1,2-diene;prop-2-enoic acid?
The canonical SMILES for propa-1,2-diene;prop-2-enoic acid is C=C=C.C=CC(=O)O.
What is the InChIKey of propa-1,2-diene;prop-2-enoic acid?
The InChIKey is AIAQRKDMSYYIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.C3H4/c1-2-3(4)5;1-3-2/h2H,1H2,(H,4,5);1-2H2.
What are the key properties of propa-1,2-diene;prop-2-enoic acid?
propa-1,2-diene;prop-2-enoic acid has a molecular weight of 112.13 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propa-1,2-diene;prop-2-enoic acid is sourced from PubChem (CID 87528700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).