C6H6F3N3 — CID 167032651
(2E,4Z)-2,5-diamino-3-(trifluoromethyl)penta-2,4-dienenitrile (PubChem CID 167032651) has the molecular formula C6H6F3N3 and a molecular weight of 177.13 g/mol. Its IUPAC name is (2E,4Z)-2,5-diamino-3-(trifluoromethyl)penta-2,4-dienenitrile.
| Compound Name | (2E,4Z)-2,5-diamino-3-(trifluoromethyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 167032651 |
| Molecular Formula | C6H6F3N3 |
| Molecular Weight | 177.13 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | (2E,4Z)-2,5-diamino-3-(trifluoromethyl)penta-2,4-dienenitrile |
| SMILES | N#C/C(N)=C(/C=C\N)C(F)(F)F |
| InChI | InChI=1S/C6H6F3N3/c7-6(8,9)4(1-2-10)5(12)3-11/h1-2H,10,12H2/b2-1-,5-4+ |
| InChIKey | UXZBHYGYDJXVQF-RKKGELDJSA-N |
| XLogP | 0.76 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|