C9H8N2O — CID 145284840
(2E,4Z)-2-formyl-4-(methylideneamino)hepta-2,4,6-trienenitrile (PubChem CID 145284840) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is (2E,4Z)-2-formyl-4-(methylideneamino)hepta-2,4,6-trienenitrile.
| Compound Name | (2E,4Z)-2-formyl-4-(methylideneamino)hepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 145284840 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (2E,4Z)-2-formyl-4-(methylideneamino)hepta-2,4,6-trienenitrile |
| SMILES | C=C/C=C(/C=C(\C#N)C=O)N=C |
| InChI | InChI=1S/C9H8N2O/c1-3-4-9(11-2)5-8(6-10)7-12/h3-5,7H,1-2H2/b8-5+,9-4- |
| InChIKey | XMXZKYBACMMJBR-MBXFLOIASA-N |
| XLogP | 1.41 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|