C6H8N2O — CID 143106868
N-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]formamide (PubChem CID 143106868) has the molecular formula C6H8N2O and a molecular weight of 124.14 g/mol. Its IUPAC name is N-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]formamide.
| Compound Name | N-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]formamide |
|---|---|
| PubChem CID | 143106868 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | N-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]formamide |
| SMILES | C=C/C=C(\N=C)NC=O |
| InChI | InChI=1S/C6H8N2O/c1-3-4-6(7-2)8-5-9/h3-5H,1-2H2,(H,8,9)/b6-4+ |
| InChIKey | IMCUDXUAEVTVGB-GQCTYLIASA-N |
| XLogP | 0.46 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|