C16H22FNO — CID 143900311
ethane;1-fluoro-2-methylbenzene;N-[(3E)-hexa-1,3,5-trien-3-yl]formamide (PubChem CID 143900311) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is ethane;1-fluoro-2-methylbenzene;N-[(3E)-hexa-1,3,5-trien-3-yl]formamide.
| Compound Name | ethane;1-fluoro-2-methylbenzene;N-[(3E)-hexa-1,3,5-trien-3-yl]formamide |
|---|---|
| PubChem CID | 143900311 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | ethane;1-fluoro-2-methylbenzene;N-[(3E)-hexa-1,3,5-trien-3-yl]formamide |
| SMILES | C=C/C=C(\C=C)NC=O.CC.Cc1ccccc1F |
| InChI | InChI=1S/C7H7F.C7H9NO.C2H6/c1-6-4-2-3-5-7(6)8;1-3-5-7(4-2)8-6-9;1-2/h2-5H,1H3;3-6H,1-2H2,(H,8,9);1-2H3/b;7-5+; |
| InChIKey | IHYMZQOTLGWDQU-QVSSGMAGSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|