C6H9NO — CID 143712390
(2Z)-2-(methylideneamino)penta-2,4-dien-1-ol (PubChem CID 143712390) has the molecular formula C6H9NO and a molecular weight of 111.14 g/mol. Its IUPAC name is (2Z)-2-(methylideneamino)penta-2,4-dien-1-ol.
| Compound Name | (2Z)-2-(methylideneamino)penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 143712390 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | (2Z)-2-(methylideneamino)penta-2,4-dien-1-ol |
| SMILES | C=C/C=C(/CO)N=C |
| InChI | InChI=1S/C6H9NO/c1-3-4-6(5-8)7-2/h3-4,8H,1-2,5H2/b6-4- |
| InChIKey | NLUWBEGLGWLSBL-XQRVVYSFSA-N |
| XLogP | 0.75 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|