C9H15N — CID 143137325
N-[(3E)-6-methylhepta-3,5-dien-3-yl]methanimine (PubChem CID 143137325) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is N-[(3E)-6-methylhepta-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3E)-6-methylhepta-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 143137325 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N-[(3E)-6-methylhepta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C/C=C(C)C)CC |
| InChI | InChI=1S/C9H15N/c1-5-9(10-4)7-6-8(2)3/h6-7H,4-5H2,1-3H3/b9-7+ |
| InChIKey | UQVLQDARIBHXNV-VQHVLOKHSA-N |
| XLogP | 2.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|