C11H20N4 — CID 134406292
(1E,3Z)-4-(methylideneamino)-1-piperazin-1-ylhexa-1,3-dien-1-amine (PubChem CID 134406292) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is (1E,3Z)-4-(methylideneamino)-1-piperazin-1-ylhexa-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-4-(methylideneamino)-1-piperazin-1-ylhexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134406292 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | (1E,3Z)-4-(methylideneamino)-1-piperazin-1-ylhexa-1,3-dien-1-amine |
| SMILES | C=N/C(=C\C=C(/N)N1CCNCC1)CC |
| InChI | InChI=1S/C11H20N4/c1-3-10(13-2)4-5-11(12)15-8-6-14-7-9-15/h4-5,14H,2-3,6-9,12H2,1H3/b10-4-,11-5+ |
| InChIKey | VGXRDQXGNDMAIG-WIZYTBDYSA-N |
| XLogP | 0.69 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|