C11H20IN3 — CID 134406327
(1E,3E)-1-iodo-4-(piperazin-1-ylmethyl)hexa-1,3-dien-1-amine (PubChem CID 134406327) has the molecular formula C11H20IN3 and a molecular weight of 321.21 g/mol. Its IUPAC name is (1E,3E)-1-iodo-4-(piperazin-1-ylmethyl)hexa-1,3-dien-1-amine.
| Compound Name | (1E,3E)-1-iodo-4-(piperazin-1-ylmethyl)hexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134406327 |
| Molecular Formula | C11H20IN3 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | (1E,3E)-1-iodo-4-(piperazin-1-ylmethyl)hexa-1,3-dien-1-amine |
| SMILES | CC/C(=C\C=C(/N)I)CN1CCNCC1 |
| InChI | InChI=1S/C11H20IN3/c1-2-10(3-4-11(12)13)9-15-7-5-14-6-8-15/h3-4,14H,2,5-9,13H2,1H3/b10-3+,11-4- |
| InChIKey | OJFJHFYRZNBLTL-RGXGGPSXSA-N |
| XLogP | 1.46 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|