C13H24N2 — CID 129043366
1-[(3E,5Z)-3-ethylhepta-3,5-dienyl]piperazine (PubChem CID 129043366) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-[(3E,5Z)-3-ethylhepta-3,5-dienyl]piperazine.
| Compound Name | 1-[(3E,5Z)-3-ethylhepta-3,5-dienyl]piperazine |
|---|---|
| PubChem CID | 129043366 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-[(3E,5Z)-3-ethylhepta-3,5-dienyl]piperazine |
| SMILES | C/C=C\C=C(/CC)CCN1CCNCC1 |
| InChI | InChI=1S/C13H24N2/c1-3-5-6-13(4-2)7-10-15-11-8-14-9-12-15/h3,5-6,14H,4,7-12H2,1-2H3/b5-3-,13-6+ |
| InChIKey | ITFFIXXPYCXYHG-ZPOUSACNSA-N |
| XLogP | 2.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|