C24H40N2S — CID 144698876
ethane;1-[2-[(2Z,4E,7E,9Z)-5-ethenyl-7-[(Z)-prop-1-enyl]undeca-2,4,7,9-tetraen-6-yl]sulfanylethyl]piperazine (PubChem CID 144698876) has the molecular formula C24H40N2S and a molecular weight of 388.67 g/mol. Its IUPAC name is ethane;1-[2-[(2Z,4E,7E,9Z)-5-ethenyl-7-[(Z)-prop-1-enyl]undeca-2,4,7,9-tetraen-6-yl]sulfanylethyl]piperazine.
| Compound Name | ethane;1-[2-[(2Z,4E,7E,9Z)-5-ethenyl-7-[(Z)-prop-1-enyl]undeca-2,4,7,9-tetraen-6-yl]sulfanylethyl]piperazine |
|---|---|
| PubChem CID | 144698876 |
| Molecular Formula | C24H40N2S |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | ethane;1-[2-[(2Z,4E,7E,9Z)-5-ethenyl-7-[(Z)-prop-1-enyl]undeca-2,4,7,9-tetraen-6-yl]sulfanylethyl]piperazine |
| SMILES | C=C/C(=C\C=C/C)C(SCCN1CCNCC1)C(/C=C\C)=C/C=C\C.CC |
| InChI | InChI=1S/C22H34N2S.C2H6/c1-5-9-12-20(8-4)22(21(11-7-3)13-10-6-2)25-19-18-24-16-14-23-15-17-24;1-2/h5-13,22-23H,4,14-19H2,1-3H3;1-2H3/b9-5-,10-6-,11-7-,20-12+,21-13+; |
| InChIKey | FRSVKSADQZGJIM-JSMCWBKXSA-N |
| XLogP | 5.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|