C20H28N2S — CID 144698887
1-[2-[(2E,4Z)-2-ethenyl-1-phenylhexa-2,4-dienyl]sulfanylethyl]piperazine (PubChem CID 144698887) has the molecular formula C20H28N2S and a molecular weight of 328.53 g/mol. Its IUPAC name is 1-[2-[(2E,4Z)-2-ethenyl-1-phenylhexa-2,4-dienyl]sulfanylethyl]piperazine.
| Compound Name | 1-[2-[(2E,4Z)-2-ethenyl-1-phenylhexa-2,4-dienyl]sulfanylethyl]piperazine |
|---|---|
| PubChem CID | 144698887 |
| Molecular Formula | C20H28N2S |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-[2-[(2E,4Z)-2-ethenyl-1-phenylhexa-2,4-dienyl]sulfanylethyl]piperazine |
| SMILES | C=C/C(=C\C=C/C)C(SCCN1CCNCC1)c1ccccc1 |
| InChI | InChI=1S/C20H28N2S/c1-3-5-9-18(4-2)20(19-10-7-6-8-11-19)23-17-16-22-14-12-21-13-15-22/h3-11,20-21H,2,12-17H2,1H3/b5-3-,18-9+ |
| InChIKey | RILWHHATACYGFY-HYKPSHSXSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|