C14H22F2 — CID 134556295
(6E)-6-ethyl-3,3-difluoro-2,9-dimethyldeca-1,6,8-triene (PubChem CID 134556295) has the molecular formula C14H22F2 and a molecular weight of 228.33 g/mol. Its IUPAC name is (6E)-6-ethyl-3,3-difluoro-2,9-dimethyldeca-1,6,8-triene.
| Compound Name | (6E)-6-ethyl-3,3-difluoro-2,9-dimethyldeca-1,6,8-triene |
|---|---|
| PubChem CID | 134556295 |
| Molecular Formula | C14H22F2 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (6E)-6-ethyl-3,3-difluoro-2,9-dimethyldeca-1,6,8-triene |
| SMILES | C=C(C)C(F)(F)CC/C(=C/C=C(C)C)CC |
| InChI | InChI=1S/C14H22F2/c1-6-13(8-7-11(2)3)9-10-14(15,16)12(4)5/h7-8H,4,6,9-10H2,1-3,5H3/b13-8+ |
| InChIKey | GZXSMEBBVRSGNI-MDWZMJQESA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|