C12H24 — CID 168939588
ethane;(3E)-4-ethyl-2-methylhepta-1,3-diene (PubChem CID 168939588) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is ethane;(3E)-4-ethyl-2-methylhepta-1,3-diene.
| Compound Name | ethane;(3E)-4-ethyl-2-methylhepta-1,3-diene |
|---|---|
| PubChem CID | 168939588 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | ethane;(3E)-4-ethyl-2-methylhepta-1,3-diene |
| SMILES | C=C(C)/C=C(\CC)CCC.CC |
| InChI | InChI=1S/C10H18.C2H6/c1-5-7-10(6-2)8-9(3)4;1-2/h8H,3,5-7H2,1-2,4H3;1-2H3/b10-8+; |
| InChIKey | WIYTXBRLADEAKI-VRTOBVRTSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|