About 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane
2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane (PubChem CID 175295978) has the molecular formula C22H38O4
and a molecular weight of 366.54 g/mol. Its IUPAC name is 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane.
Molecular Properties
| Compound Name | 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane |
| PubChem CID | 175295978 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane |
| SMILES | C=C(C)C=C(CCCCCC)CCCCCC.C=C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H32.C5H6O4/c1-5-7-9-11-13-17(15-16(3)4)14-12-10-8-6-2;1-3(5(8)9)2-4(6)7/h15H,3,5-14H2,1-2,4H3;1-2H2,(H,6,7)(H,8,9) |
| InChIKey | GPTQVWWOTMAQQI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane?
The IUPAC name of 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane (CID 175295978) is 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane.
What is the SMILES notation for 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane?
The canonical SMILES for 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane is C=C(C)C=C(CCCCCC)CCCCCC.C=C(CC(=O)O)C(=O)O.
What is the InChIKey of 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane?
The InChIKey is GPTQVWWOTMAQQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32.C5H6O4/c1-5-7-9-11-13-17(15-16(3)4)14-12-10-8-6-2;1-3(5(8)9)2-4(6)7/h15H,3,5-14H2,1-2,4H3;1-2H2,(H,6,7)(H,8,9).
What are the key properties of 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane?
2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane has a molecular weight of 366.54 g/mol, XLogP of 6.53, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenebutanedioic acid;7-(2-methylprop-2-enylidene)tridecane is sourced from PubChem (CID 175295978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).