About hexanoic acid;2-methylprop-2-enoic acid;zinc
hexanoic acid;2-methylprop-2-enoic acid;zinc (PubChem CID 174858800) has the molecular formula C10H18O4Zn
and a molecular weight of 267.64 g/mol. Its IUPAC name is hexanoic acid;2-methylprop-2-enoic acid;zinc.
Molecular Properties
| Compound Name | hexanoic acid;2-methylprop-2-enoic acid;zinc |
| PubChem CID | 174858800 |
| Molecular Formula | C10H18O4Zn |
| Molecular Weight | 267.64 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | hexanoic acid;2-methylprop-2-enoic acid;zinc |
| SMILES | C=C(C)C(=O)O.CCCCCC(=O)O.[Zn] |
| InChI | InChI=1S/C6H12O2.C4H6O2.Zn/c1-2-3-4-5-6(7)8;1-3(2)4(5)6;/h2-5H2,1H3,(H,7,8);1H2,2H3,(H,5,6); |
| InChIKey | ZJFXDPCMHYDRKN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.64 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hexanoic acid;2-methylprop-2-enoic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoic acid;2-methylprop-2-enoic acid;zinc?
The IUPAC name of hexanoic acid;2-methylprop-2-enoic acid;zinc (CID 174858800) is hexanoic acid;2-methylprop-2-enoic acid;zinc.
What is the SMILES notation for hexanoic acid;2-methylprop-2-enoic acid;zinc?
The canonical SMILES for hexanoic acid;2-methylprop-2-enoic acid;zinc is C=C(C)C(=O)O.CCCCCC(=O)O.[Zn].
What is the InChIKey of hexanoic acid;2-methylprop-2-enoic acid;zinc?
The InChIKey is ZJFXDPCMHYDRKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C4H6O2.Zn/c1-2-3-4-5-6(7)8;1-3(2)4(5)6;/h2-5H2,1H3,(H,7,8);1H2,2H3,(H,5,6);.
What are the key properties of hexanoic acid;2-methylprop-2-enoic acid;zinc?
hexanoic acid;2-methylprop-2-enoic acid;zinc has a molecular weight of 267.64 g/mol, XLogP of 2.30, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoic acid;2-methylprop-2-enoic acid;zinc is sourced from PubChem (CID 174858800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).