About bis(decanoic acid);zinc
bis(decanoic acid);zinc (PubChem CID 118855949) has the molecular formula C20H40O4Zn
and a molecular weight of 409.93 g/mol. Its IUPAC name is bis(decanoic acid);zinc.
Molecular Properties
| Compound Name | bis(decanoic acid);zinc |
| PubChem CID | 118855949 |
| Molecular Formula | C20H40O4Zn |
| Molecular Weight | 409.93 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | bis(decanoic acid);zinc |
| SMILES | CCCCCCCCCC(=O)O.CCCCCCCCCC(=O)O.[Zn] |
| InChI | InChI=1S/2C10H20O2.Zn/c2*1-2-3-4-5-6-7-8-9-10(11)12;/h2*2-9H2,1H3,(H,11,12); |
| InChIKey | SZSKSDNKLVWNFV-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.93 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(decanoic acid);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(decanoic acid);zinc?
The IUPAC name of bis(decanoic acid);zinc (CID 118855949) is bis(decanoic acid);zinc.
What is the SMILES notation for bis(decanoic acid);zinc?
The canonical SMILES for bis(decanoic acid);zinc is CCCCCCCCCC(=O)O.CCCCCCCCCC(=O)O.[Zn].
What is the InChIKey of bis(decanoic acid);zinc?
The InChIKey is SZSKSDNKLVWNFV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H20O2.Zn/c2*1-2-3-4-5-6-7-8-9-10(11)12;/h2*2-9H2,1H3,(H,11,12);.
What are the key properties of bis(decanoic acid);zinc?
bis(decanoic acid);zinc has a molecular weight of 409.93 g/mol, XLogP of 6.42, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(decanoic acid);zinc is sourced from PubChem (CID 118855949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).