About (E)-3-propylnon-2-enoic acid
(E)-3-propylnon-2-enoic acid (PubChem CID 176810822) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (E)-3-propylnon-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-propylnon-2-enoic acid |
| PubChem CID | 176810822 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (E)-3-propylnon-2-enoic acid |
| SMILES | CCCCCC/C(=C/C(=O)O)CCC |
| InChI | InChI=1S/C12H22O2/c1-3-5-6-7-9-11(8-4-2)10-12(13)14/h10H,3-9H2,1-2H3,(H,13,14)/b11-10+ |
| InChIKey | ZAEJZPQARKGLRH-ZHACJKMWSA-N |
| XLogP | 3.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-propylnon-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-propylnon-2-enoic acid?
The IUPAC name of (E)-3-propylnon-2-enoic acid (CID 176810822) is (E)-3-propylnon-2-enoic acid.
What is the SMILES notation for (E)-3-propylnon-2-enoic acid?
The canonical SMILES for (E)-3-propylnon-2-enoic acid is CCCCCC/C(=C/C(=O)O)CCC.
What is the InChIKey of (E)-3-propylnon-2-enoic acid?
The InChIKey is ZAEJZPQARKGLRH-ZHACJKMWSA-N. The full InChI is InChI=1S/C12H22O2/c1-3-5-6-7-9-11(8-4-2)10-12(13)14/h10H,3-9H2,1-2H3,(H,13,14)/b11-10+.
What are the key properties of (E)-3-propylnon-2-enoic acid?
(E)-3-propylnon-2-enoic acid has a molecular weight of 198.31 g/mol, XLogP of 3.77, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-propylnon-2-enoic acid is sourced from PubChem (CID 176810822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).