(E)-3-propylnon-2-enoic acid

C12H22O2 — CID 176810822

IUPAC(E)-3-propylnon-2-enoic acid
SMILESCCCCCC/C(=C/C(=O)O)CCC
InChIInChI=1S/C12H22O2/c1-3-5-6-7-9-11(8-4-2)10-12(13)14/h10H,3-9H2,1-2H3,(H,13,14)/b11-10+
InChIKeyZAEJZPQARKGLRH-ZHACJKMWSA-N
MW198.31 g/mol
LogP3.77
Rot. Bonds8

About (E)-3-propylnon-2-enoic acid

(E)-3-propylnon-2-enoic acid (PubChem CID 176810822) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (E)-3-propylnon-2-enoic acid.

Molecular Properties

Compound Name(E)-3-propylnon-2-enoic acid
PubChem CID176810822
Molecular FormulaC12H22O2
Molecular Weight198.31 g/mol
Exact Mass198.16
IUPAC Name(E)-3-propylnon-2-enoic acid
SMILESCCCCCC/C(=C/C(=O)O)CCC
InChIInChI=1S/C12H22O2/c1-3-5-6-7-9-11(8-4-2)10-12(13)14/h10H,3-9H2,1-2H3,(H,13,14)/b11-10+
InChIKeyZAEJZPQARKGLRH-ZHACJKMWSA-N
XLogP3.77
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds8
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.31
LogP ≤ 53.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-propylnon-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-propylnon-2-enoic acid?
The IUPAC name of (E)-3-propylnon-2-enoic acid (CID 176810822) is (E)-3-propylnon-2-enoic acid.
What is the SMILES notation for (E)-3-propylnon-2-enoic acid?
The canonical SMILES for (E)-3-propylnon-2-enoic acid is CCCCCC/C(=C/C(=O)O)CCC.
What is the InChIKey of (E)-3-propylnon-2-enoic acid?
The InChIKey is ZAEJZPQARKGLRH-ZHACJKMWSA-N. The full InChI is InChI=1S/C12H22O2/c1-3-5-6-7-9-11(8-4-2)10-12(13)14/h10H,3-9H2,1-2H3,(H,13,14)/b11-10+.
What are the key properties of (E)-3-propylnon-2-enoic acid?
(E)-3-propylnon-2-enoic acid has a molecular weight of 198.31 g/mol, XLogP of 3.77, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-propylnon-2-enoic acid is sourced from PubChem (CID 176810822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).