About (E)-3-ethylundec-2-enoic acid
(E)-3-ethylundec-2-enoic acid (PubChem CID 19989078) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is (E)-3-ethylundec-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-ethylundec-2-enoic acid |
| PubChem CID | 19989078 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (E)-3-ethylundec-2-enoic acid |
| SMILES | CCCCCCCC/C(=C/C(=O)O)CC |
| InChI | InChI=1S/C13H24O2/c1-3-5-6-7-8-9-10-12(4-2)11-13(14)15/h11H,3-10H2,1-2H3,(H,14,15)/b12-11+ |
| InChIKey | DGFTWPLUNSGYME-VAWYXSNFSA-N |
| XLogP | 4.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-ethylundec-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-ethylundec-2-enoic acid?
The IUPAC name of (E)-3-ethylundec-2-enoic acid (CID 19989078) is (E)-3-ethylundec-2-enoic acid.
What is the SMILES notation for (E)-3-ethylundec-2-enoic acid?
The canonical SMILES for (E)-3-ethylundec-2-enoic acid is CCCCCCCC/C(=C/C(=O)O)CC.
What is the InChIKey of (E)-3-ethylundec-2-enoic acid?
The InChIKey is DGFTWPLUNSGYME-VAWYXSNFSA-N. The full InChI is InChI=1S/C13H24O2/c1-3-5-6-7-8-9-10-12(4-2)11-13(14)15/h11H,3-10H2,1-2H3,(H,14,15)/b12-11+.
What are the key properties of (E)-3-ethylundec-2-enoic acid?
(E)-3-ethylundec-2-enoic acid has a molecular weight of 212.33 g/mol, XLogP of 4.16, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-ethylundec-2-enoic acid is sourced from PubChem (CID 19989078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).