C15H16F8 — CID 144809560
3,3,4,4,7,7,8,8-octafluoro-2-methyl-5,6,9-trimethylideneundec-1-ene (PubChem CID 144809560) has the molecular formula C15H16F8 and a molecular weight of 348.28 g/mol. Its IUPAC name is 3,3,4,4,7,7,8,8-octafluoro-2-methyl-5,6,9-trimethylideneundec-1-ene.
| Compound Name | 3,3,4,4,7,7,8,8-octafluoro-2-methyl-5,6,9-trimethylideneundec-1-ene |
|---|---|
| PubChem CID | 144809560 |
| Molecular Formula | C15H16F8 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 3,3,4,4,7,7,8,8-octafluoro-2-methyl-5,6,9-trimethylideneundec-1-ene |
| SMILES | C=C(C)C(F)(F)C(F)(F)C(=C)C(=C)C(F)(F)C(F)(F)C(=C)CC |
| InChI | InChI=1S/C15H16F8/c1-7-9(4)13(18,19)15(22,23)11(6)10(5)14(20,21)12(16,17)8(2)3/h2,4-7H2,1,3H3 |
| InChIKey | LEWJVGOGOUWSDS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|