C13H22 — CID 176966734
(4Z)-2,5,7,7-tetramethyl-6-methylideneocta-2,4-diene (PubChem CID 176966734) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is (4Z)-2,5,7,7-tetramethyl-6-methylideneocta-2,4-diene.
| Compound Name | (4Z)-2,5,7,7-tetramethyl-6-methylideneocta-2,4-diene |
|---|---|
| PubChem CID | 176966734 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | (4Z)-2,5,7,7-tetramethyl-6-methylideneocta-2,4-diene |
| SMILES | C=C(/C(C)=C\C=C(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H22/c1-10(2)8-9-11(3)12(4)13(5,6)7/h8-9H,4H2,1-3,5-7H3/b11-9- |
| InChIKey | UGVGTSCBTZDDDI-LUAWRHEFSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|