C16H26N2 — CID 170123214
(4E)-N,2,2,7-tetramethyl-3-methylidene-N-[(Z)-prop-2-enylideneamino]octa-4,6-dien-4-amine (PubChem CID 170123214) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (4E)-N,2,2,7-tetramethyl-3-methylidene-N-[(Z)-prop-2-enylideneamino]octa-4,6-dien-4-amine.
| Compound Name | (4E)-N,2,2,7-tetramethyl-3-methylidene-N-[(Z)-prop-2-enylideneamino]octa-4,6-dien-4-amine |
|---|---|
| PubChem CID | 170123214 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (4E)-N,2,2,7-tetramethyl-3-methylidene-N-[(Z)-prop-2-enylideneamino]octa-4,6-dien-4-amine |
| SMILES | C=C/C=N\N(C)/C(=C/C=C(C)C)C(=C)C(C)(C)C |
| InChI | InChI=1S/C16H26N2/c1-9-12-17-18(8)15(11-10-13(2)3)14(4)16(5,6)7/h9-12H,1,4H2,2-3,5-8H3/b15-11+,17-12- |
| InChIKey | QFEGQBPIEOKKEV-GLDUUKHASA-N |
| XLogP | 4.54 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|