C17H22S — CID 139398032
(2E,4Z)-5,7-dimethyl-6-methylidene-7-phenylocta-2,4-diene-2-thiol (PubChem CID 139398032) has the molecular formula C17H22S and a molecular weight of 258.43 g/mol. Its IUPAC name is (2E,4Z)-5,7-dimethyl-6-methylidene-7-phenylocta-2,4-diene-2-thiol.
| Compound Name | (2E,4Z)-5,7-dimethyl-6-methylidene-7-phenylocta-2,4-diene-2-thiol |
|---|---|
| PubChem CID | 139398032 |
| Molecular Formula | C17H22S |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (2E,4Z)-5,7-dimethyl-6-methylidene-7-phenylocta-2,4-diene-2-thiol |
| SMILES | C=C(/C(C)=C\C=C(/C)S)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H22S/c1-13(11-12-14(2)18)15(3)17(4,5)16-9-7-6-8-10-16/h6-12,18H,3H2,1-2,4-5H3/b13-11-,14-12+ |
| InChIKey | NKQFGBIBYABJFI-HEEUSZRZSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|