C13H14INO2S — CID 162378371
[4-[(2Z)-2-(methylideneamino)penta-2,4-dienoxy]phenyl]methoxy thiohypoiodite (PubChem CID 162378371) has the molecular formula C13H14INO2S and a molecular weight of 375.23 g/mol. Its IUPAC name is [4-[(2Z)-2-(methylideneamino)penta-2,4-dienoxy]phenyl]methoxy thiohypoiodite.
| Compound Name | [4-[(2Z)-2-(methylideneamino)penta-2,4-dienoxy]phenyl]methoxy thiohypoiodite |
|---|---|
| PubChem CID | 162378371 |
| Molecular Formula | C13H14INO2S |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | [4-[(2Z)-2-(methylideneamino)penta-2,4-dienoxy]phenyl]methoxy thiohypoiodite |
| SMILES | C=C/C=C(/COc1ccc(COSI)cc1)N=C |
| InChI | InChI=1S/C13H14INO2S/c1-3-4-12(15-2)10-16-13-7-5-11(6-8-13)9-17-18-14/h3-8H,1-2,9-10H2/b12-4- |
| InChIKey | DLJKJSVQOATTCQ-QCDXTXTGSA-N |
| XLogP | 4.35 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|