C15H19NO3S — CID 142107152
2-[4-[(Z)-2-methyl-3-(methylideneamino)-4-methylsulfanylbut-3-enyl]phenoxy]acetic acid (PubChem CID 142107152) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[4-[(Z)-2-methyl-3-(methylideneamino)-4-methylsulfanylbut-3-enyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-2-methyl-3-(methylideneamino)-4-methylsulfanylbut-3-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 142107152 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-[4-[(Z)-2-methyl-3-(methylideneamino)-4-methylsulfanylbut-3-enyl]phenoxy]acetic acid |
| SMILES | C=N/C(=C\SC)C(C)Cc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO3S/c1-11(14(16-2)10-20-3)8-12-4-6-13(7-5-12)19-9-15(17)18/h4-7,10-11H,2,8-9H2,1,3H3,(H,17,18)/b14-10- |
| InChIKey | SQOYVNHUSDAVQQ-UVTDQMKNSA-N |
| XLogP | 3.23 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|