C12H16N2O2 — CID 142586076
4-formamido-N-[(3E)-hexa-1,3,5-trien-3-yl]pent-4-enamide (PubChem CID 142586076) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 4-formamido-N-[(3E)-hexa-1,3,5-trien-3-yl]pent-4-enamide.
| Compound Name | 4-formamido-N-[(3E)-hexa-1,3,5-trien-3-yl]pent-4-enamide |
|---|---|
| PubChem CID | 142586076 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 4-formamido-N-[(3E)-hexa-1,3,5-trien-3-yl]pent-4-enamide |
| SMILES | C=C/C=C(\C=C)NC(=O)CCC(=C)NC=O |
| InChI | InChI=1S/C12H16N2O2/c1-4-6-11(5-2)14-12(16)8-7-10(3)13-9-15/h4-6,9H,1-3,7-8H2,(H,13,15)(H,14,16)/b11-6+ |
| InChIKey | BBXBVWZIQSLEEI-IZZDOVSWSA-N |
| XLogP | 1.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|