C15H24N2O — CID 166980964
1-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2,2,4,4-tetramethylcyclobutyl)urea (PubChem CID 166980964) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2,2,4,4-tetramethylcyclobutyl)urea.
| Compound Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2,2,4,4-tetramethylcyclobutyl)urea |
|---|---|
| PubChem CID | 166980964 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2,2,4,4-tetramethylcyclobutyl)urea |
| SMILES | C=C/C=C(\C=C)NC(=O)NC1C(C)(C)CC1(C)C |
| InChI | InChI=1S/C15H24N2O/c1-7-9-11(8-2)16-13(18)17-12-14(3,4)10-15(12,5)6/h7-9,12H,1-2,10H2,3-6H3,(H2,16,17,18)/b11-9+ |
| InChIKey | BCFMLWOMBCOLCY-PKNBQFBNSA-N |
| XLogP | 3.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|