C15H25NO2 — CID 170398021
2-methylidene-5-oxo-N-(2,2,4,4-tetramethylcyclobutyl)hexanamide (PubChem CID 170398021) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-methylidene-5-oxo-N-(2,2,4,4-tetramethylcyclobutyl)hexanamide.
| Compound Name | 2-methylidene-5-oxo-N-(2,2,4,4-tetramethylcyclobutyl)hexanamide |
|---|---|
| PubChem CID | 170398021 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-methylidene-5-oxo-N-(2,2,4,4-tetramethylcyclobutyl)hexanamide |
| SMILES | C=C(CCC(C)=O)C(=O)NC1C(C)(C)CC1(C)C |
| InChI | InChI=1S/C15H25NO2/c1-10(7-8-11(2)17)12(18)16-13-14(3,4)9-15(13,5)6/h13H,1,7-9H2,2-6H3,(H,16,18) |
| InChIKey | YEBDOIMBTJZEAW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|