C21H30N2O2 — CID 177325924
4-(4-formylpiperidin-1-yl)-N-(2,2,4,4-tetramethylcyclobutyl)benzamide (PubChem CID 177325924) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 4-(4-formylpiperidin-1-yl)-N-(2,2,4,4-tetramethylcyclobutyl)benzamide.
| Compound Name | 4-(4-formylpiperidin-1-yl)-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
|---|---|
| PubChem CID | 177325924 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 4-(4-formylpiperidin-1-yl)-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
| SMILES | CC1(C)CC(C)(C)C1NC(=O)c1ccc(N2CCC(C=O)CC2)cc1 |
| InChI | InChI=1S/C21H30N2O2/c1-20(2)14-21(3,4)19(20)22-18(25)16-5-7-17(8-6-16)23-11-9-15(13-24)10-12-23/h5-8,13,15,19H,9-12,14H2,1-4H3,(H,22,25) |
| InChIKey | MPVJDYFUGNISFL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|