C17H21N3O3 — CID 159330945
N-(2,4-dioxocyclohexyl)-4-piperazin-1-ylbenzamide (PubChem CID 159330945) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-(2,4-dioxocyclohexyl)-4-piperazin-1-ylbenzamide.
| Compound Name | N-(2,4-dioxocyclohexyl)-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 159330945 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-(2,4-dioxocyclohexyl)-4-piperazin-1-ylbenzamide |
| SMILES | O=C1CCC(NC(=O)c2ccc(N3CCNCC3)cc2)C(=O)C1 |
| InChI | InChI=1S/C17H21N3O3/c21-14-5-6-15(16(22)11-14)19-17(23)12-1-3-13(4-2-12)20-9-7-18-8-10-20/h1-4,15,18H,5-11H2,(H,19,23) |
| InChIKey | VVEZPNUXPKZACS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|