C15H17NO3 — CID 160538684
N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide (PubChem CID 160538684) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide.
| Compound Name | N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 160538684 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide |
| SMILES | Cc1cccc(C)c1C(=O)NC1CCC(=O)CC1=O |
| InChI | InChI=1S/C15H17NO3/c1-9-4-3-5-10(2)14(9)15(19)16-12-7-6-11(17)8-13(12)18/h3-5,12H,6-8H2,1-2H3,(H,16,19) |
| InChIKey | QWMINIFBLAPDFC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|