About N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide
N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide (PubChem CID 160538684) has the molecular formula C15H17NO3
and a molecular weight of 259.30 g/mol. Its IUPAC name is N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide |
| PubChem CID | 160538684 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide |
| SMILES | Cc1cccc(C)c1C(=O)NC1CCC(=O)CC1=O |
| InChI | InChI=1S/C15H17NO3/c1-9-4-3-5-10(2)14(9)15(19)16-12-7-6-11(17)8-13(12)18/h3-5,12H,6-8H2,1-2H3,(H,16,19) |
| InChIKey | QWMINIFBLAPDFC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide?
The IUPAC name of N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide (CID 160538684) is N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide.
What is the SMILES notation for N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide?
The canonical SMILES for N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide is Cc1cccc(C)c1C(=O)NC1CCC(=O)CC1=O.
What is the InChIKey of N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide?
The InChIKey is QWMINIFBLAPDFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3/c1-9-4-3-5-10(2)14(9)15(19)16-12-7-6-11(17)8-13(12)18/h3-5,12H,6-8H2,1-2H3,(H,16,19).
What are the key properties of N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide?
N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide has a molecular weight of 259.30 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dioxocyclohexyl)-2,6-dimethylbenzamide is sourced from PubChem (CID 160538684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).