C18H17NO2 — CID 160711449
N-(4-methylidene-2-oxocyclohexyl)naphthalene-1-carboxamide (PubChem CID 160711449) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(4-methylidene-2-oxocyclohexyl)naphthalene-1-carboxamide.
| Compound Name | N-(4-methylidene-2-oxocyclohexyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 160711449 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-(4-methylidene-2-oxocyclohexyl)naphthalene-1-carboxamide |
| SMILES | C=C1CCC(NC(=O)c2cccc3ccccc23)C(=O)C1 |
| InChI | InChI=1S/C18H17NO2/c1-12-9-10-16(17(20)11-12)19-18(21)15-8-4-6-13-5-2-3-7-14(13)15/h2-8,16H,1,9-11H2,(H,19,21) |
| InChIKey | ZEYMLJQYMRBTQV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|