C16H13NO4 — CID 54389297
N-[(3S)-2,6-dioxooxan-3-yl]naphthalene-1-carboxamide (PubChem CID 54389297) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is N-[(3S)-2,6-dioxooxan-3-yl]naphthalene-1-carboxamide.
| Compound Name | N-[(3S)-2,6-dioxooxan-3-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 54389297 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-[(3S)-2,6-dioxooxan-3-yl]naphthalene-1-carboxamide |
| SMILES | O=C1CC[C@H](NC(=O)c2cccc3ccccc23)C(=O)O1 |
| InChI | InChI=1S/C16H13NO4/c18-14-9-8-13(16(20)21-14)17-15(19)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,13H,8-9H2,(H,17,19)/t13-/m0/s1 |
| InChIKey | VFMHEQUIDMXOGQ-ZDUSSCGKSA-N |
| XLogP | 1.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|