C26H28N4O7 — CID 59098423
(4S,7S)-N-[(3S)-2-methoxy-5-oxooxolan-3-yl]-7-(naphthalene-1-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide (PubChem CID 59098423) has the molecular formula C26H28N4O7 and a molecular weight of 508.53 g/mol. Its IUPAC name is (4S,7S)-N-[(3S)-2-methoxy-5-oxooxolan-3-yl]-7-(naphthalene-1-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide.
| Compound Name | (4S,7S)-N-[(3S)-2-methoxy-5-oxooxolan-3-yl]-7-(naphthalene-1-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 59098423 |
| Molecular Formula | C26H28N4O7 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (4S,7S)-N-[(3S)-2-methoxy-5-oxooxolan-3-yl]-7-(naphthalene-1-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
| SMILES | COC1OC(=O)C[C@@H]1NC(=O)[C@@H]1CCCN2C(=O)CC[C@H](NC(=O)c3cccc4ccccc34)C(=O)N12 |
| InChI | InChI=1S/C26H28N4O7/c1-36-26-19(14-22(32)37-26)28-24(34)20-10-5-13-29-21(31)12-11-18(25(35)30(20)29)27-23(33)17-9-4-7-15-6-2-3-8-16(15)17/h2-4,6-9,18-20,26H,5,10-14H2,1H3,(H,27,33)(H,28,34)/t18-,19-,20-,26?/m0/s1 |
| InChIKey | JTBXVROAOCAQJX-YYGQQRNOSA-N |
| XLogP | 0.87 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |