C25H33N5O7 — CID 59947893
(4S,7S)-7-[[3-(dimethylamino)benzoyl]amino]-N-[(3S)-2-ethoxy-5-oxooxolan-3-yl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide (PubChem CID 59947893) has the molecular formula C25H33N5O7 and a molecular weight of 515.57 g/mol. Its IUPAC name is (4S,7S)-7-[[3-(dimethylamino)benzoyl]amino]-N-[(3S)-2-ethoxy-5-oxooxolan-3-yl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide.
| Compound Name | (4S,7S)-7-[[3-(dimethylamino)benzoyl]amino]-N-[(3S)-2-ethoxy-5-oxooxolan-3-yl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 59947893 |
| Molecular Formula | C25H33N5O7 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (4S,7S)-7-[[3-(dimethylamino)benzoyl]amino]-N-[(3S)-2-ethoxy-5-oxooxolan-3-yl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
| SMILES | CCOC1OC(=O)C[C@@H]1NC(=O)[C@@H]1CCCN2C(=O)CC[C@H](NC(=O)c3cccc(N(C)C)c3)C(=O)N12 |
| InChI | InChI=1S/C25H33N5O7/c1-4-36-25-18(14-21(32)37-25)27-23(34)19-9-6-12-29-20(31)11-10-17(24(35)30(19)29)26-22(33)15-7-5-8-16(13-15)28(2)3/h5,7-8,13,17-19,25H,4,6,9-12,14H2,1-3H3,(H,26,33)(H,27,34)/t17-,18-,19-,25?/m0/s1 |
| InChIKey | OWBBBCLXEFTRCM-QNLBTCDKSA-N |
| XLogP | 0.17 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |