C29H30N4O8 — CID 66756795
(4S,7S)-6,10-dioxo-7-[(2-oxo-2-phenylacetyl)amino]-N-[(2R,3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide (PubChem CID 66756795) has the molecular formula C29H30N4O8 and a molecular weight of 562.58 g/mol. Its IUPAC name is (4S,7S)-6,10-dioxo-7-[(2-oxo-2-phenylacetyl)amino]-N-[(2R,3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide.
| Compound Name | (4S,7S)-6,10-dioxo-7-[(2-oxo-2-phenylacetyl)amino]-N-[(2R,3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 66756795 |
| Molecular Formula | C29H30N4O8 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | (4S,7S)-6,10-dioxo-7-[(2-oxo-2-phenylacetyl)amino]-N-[(2R,3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
| SMILES | O=C1C[C@H](NC(=O)[C@@H]2CCCN3C(=O)CC[C@H](NC(=O)C(=O)c4ccccc4)C(=O)N23)[C@H](OCc2ccccc2)O1 |
| InChI | InChI=1S/C29H30N4O8/c34-23-14-13-20(30-27(38)25(36)19-10-5-2-6-11-19)28(39)33-22(12-7-15-32(23)33)26(37)31-21-16-24(35)41-29(21)40-17-18-8-3-1-4-9-18/h1-6,8-11,20-22,29H,7,12-17H2,(H,30,38)(H,31,37)/t20-,21-,22-,29+/m0/s1 |
| InChIKey | NFOSLLRGEXJBOR-LLIWRNBMSA-N |
| XLogP | 0.86 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|