C29H32N4O7 — CID 58356990
(4S,8S)-7-benzamido-8-methyl-6,10-dioxo-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide (PubChem CID 58356990) has the molecular formula C29H32N4O7 and a molecular weight of 548.60 g/mol. Its IUPAC name is (4S,8S)-7-benzamido-8-methyl-6,10-dioxo-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide.
| Compound Name | (4S,8S)-7-benzamido-8-methyl-6,10-dioxo-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 58356990 |
| Molecular Formula | C29H32N4O7 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | (4S,8S)-7-benzamido-8-methyl-6,10-dioxo-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
| SMILES | C[C@H]1CC(=O)N2CCC[C@@H](C(=O)N[C@H]3CC(=O)OC3OCc3ccccc3)N2C(=O)C1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H32N4O7/c1-18-15-23(34)32-14-8-13-22(33(32)28(38)25(18)31-26(36)20-11-6-3-7-12-20)27(37)30-21-16-24(35)40-29(21)39-17-19-9-4-2-5-10-19/h2-7,9-12,18,21-22,25,29H,8,13-17H2,1H3,(H,30,37)(H,31,36)/t18-,21-,22-,25?,29?/m0/s1 |
| InChIKey | ABWPGSOCKNJVAA-OFIIXBLLSA-N |
| XLogP | 1.53 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |