C35H39N5O5 — CID 170396610
4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxopyrrolo[3,4-f]isoindol-6-yl]piperidin-1-yl]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide (PubChem CID 170396610) has the molecular formula C35H39N5O5 and a molecular weight of 609.73 g/mol. Its IUPAC name is 4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxopyrrolo[3,4-f]isoindol-6-yl]piperidin-1-yl]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide.
| Compound Name | 4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxopyrrolo[3,4-f]isoindol-6-yl]piperidin-1-yl]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
|---|---|
| PubChem CID | 170396610 |
| Molecular Formula | C35H39N5O5 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | 4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxopyrrolo[3,4-f]isoindol-6-yl]piperidin-1-yl]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
| SMILES | CC1(C)CC(C)(C)C1NC(=O)c1ccc(N2CCC(n3cc4cc5c(cc4c3)C(=O)N(C3CCC(=O)NC3=O)C5=O)CC2)cc1 |
| InChI | InChI=1S/C35H39N5O5/c1-34(2)19-35(3,4)33(34)37-29(42)20-5-7-23(8-6-20)38-13-11-24(12-14-38)39-17-21-15-25-26(16-22(21)18-39)32(45)40(31(25)44)27-9-10-28(41)36-30(27)43/h5-8,15-18,24,27,33H,9-14,19H2,1-4H3,(H,37,42)(H,36,41,43) |
| InChIKey | HYDVLFWTDZGOTK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|