C37H45FN6O5 — CID 170049854
4-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]piperazin-1-yl]-2-fluoro-N-(2,2,4,4-tetramethylcyclobutyl)benzamide (PubChem CID 170049854) has the molecular formula C37H45FN6O5 and a molecular weight of 672.80 g/mol. Its IUPAC name is 4-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]piperazin-1-yl]-2-fluoro-N-(2,2,4,4-tetramethylcyclobutyl)benzamide.
| Compound Name | 4-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]piperazin-1-yl]-2-fluoro-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
|---|---|
| PubChem CID | 170049854 |
| Molecular Formula | C37H45FN6O5 |
| Molecular Weight | 672.80 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | 4-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]piperazin-1-yl]-2-fluoro-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
| SMILES | CC1(C)CC(C)(C)C1NC(=O)c1ccc(N2CCN(C3CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1F |
| InChI | InChI=1S/C37H45FN6O5/c1-36(2)21-37(3,4)35(36)40-31(46)26-8-6-24(20-28(26)38)43-17-15-42(16-18-43)22-11-13-41(14-12-22)23-5-7-25-27(19-23)34(49)44(33(25)48)29-9-10-30(45)39-32(29)47/h5-8,19-20,22,29,35H,9-18,21H2,1-4H3,(H,40,46)(H,39,45,47) |
| InChIKey | NJKNXWOMSCXNKT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.80 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|