C33H39N3O7 — CID 155296763
4-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypentoxy]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide (PubChem CID 155296763) has the molecular formula C33H39N3O7 and a molecular weight of 589.69 g/mol. Its IUPAC name is 4-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypentoxy]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide.
| Compound Name | 4-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypentoxy]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
|---|---|
| PubChem CID | 155296763 |
| Molecular Formula | C33H39N3O7 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | 4-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypentoxy]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
| SMILES | CC1(C)CC(C)(C)C1NC(=O)c1ccc(OCCCCCOc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C33H39N3O7/c1-32(2)19-33(3,4)31(32)35-27(38)20-8-10-21(11-9-20)42-16-6-5-7-17-43-22-12-13-23-24(18-22)30(41)36(29(23)40)25-14-15-26(37)34-28(25)39/h8-13,18,25,31H,5-7,14-17,19H2,1-4H3,(H,35,38)(H,34,37,39) |
| InChIKey | CWGMQYYSIVEMJI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|